E.S Unit 3 Word Scramble
|
Embed Code - If you would like this activity on your web page, copy the script below and paste it into your web page.
Normal Size Small Size show me how
Normal Size Small Size show me how
Question | Answer |
Aquatic | having to do with water |
Marine | aquatic ecosystems that contain dissolved salts |
Salinity | refers to the amount of salt dissolved in a medium (salt water) |
Photic zone | the surface layer of aquatic environment that is penetrated by sunlight |
Salt marsh | temperate zone estuaries located along seacoasts |
Estuary | environments where rivers meet the sea or where fresh water meets salt water contain a mixture of fresh water and salt water. |
Lagoon | a body of water separated from a larger body of water by a reef or strip of land |
Mangrove | coastal wetlands dominated by salt- tolerant plants. |
Amoeba | a single –celled organism that ingests its food by engulfing it with appendages called pseudo pods, or false feet, same method used for movement/locomotion. |
Extremophile | organism that lives in extreme environments. |
Aquifers | underground layer of water and permeable rock where water can be extracted using a well. |
Saturation | occurs when the space between soil particles are completely filled with water. |
Solvent | a liquid that dissolves a solute such as salt |
Homeostasis. | when a system is maintained at consistent internal environmental conditions |
Surface tension | property of water that causes it to stick to others surfaces and allows things to float due to hydrogen bonding. |
Point source pollution | any single identifiable source of pollution from which pollutants are discharged, such as a pipe, ditch, ship or factory some stack. |
Nonpoint source pollution | water pollution that enters a body of water from undefined sources |
Clean water act | federal law that regulates and governs water pollution. |
Effluent | an outflow of pollution into a body of water. |
Urban runoff | when rainwater runs over roads and driveways within a city, picking up toxic substances and eventually running into a body of water. |
Troposphere | lowest portion of the earth’s atmosphere |
Stratosphere | 2nd layer of the layer of the earth’s atmosphere just above the troposphere |
Mesosphere | layer of the earth’s atmosphere directly above the stratosphere |
Thermosphere | largest layer of the atmosphere above the mesosphere. |
Exosphere | uppermost layer of the atmosphere |
Air pollution | introducing substances into the air that may be harmful to living organisms or the environment |
Particulates | small particles that are suspended within the atmosphere |
Air pollutants | substances that cause air pollution |
Primary pollutants | directly emitted from a process or source |
Secondary pollutants | form in the air from the interaction between primary pollutants |
Ozone | atmospheric gas |
Ozone layer | layer of earth’s atmosphere that contains high amounts of ozone located about 5 to 30 miles above the earth’s surface within the stratosphere. |
Radiation | a form of energy that can cause mutations resulting in cancer |
UVB | a type of radiation emitted from the sun that can be beneficial and damaging to humans |
Ozone depleting substances (ODS) | substance that destroys ozone |
Chlorofluorocarbons(CFCs) | used as coolants, solvents and propellants |
Halon | a ozone depleting substance that is used to extinguish fires |
Created by:
jms2012
Popular Science sets