Save
Upgrade to remove ads
Busy. Please wait.
Log in with Clever
or

show password
Forgot Password?

Don't have an account?  Sign up 
Sign up using Clever
or

Username is available taken
show password


Make sure to remember your password. If you forget it there is no way for StudyStack to send you a reset link. You would need to create a new account.
Your email address is only used to allow you to reset your password. See our Privacy Policy and Terms of Service.


Already a StudyStack user? Log In

Reset Password
Enter the associated with your account, and we'll email you a link to reset your password.
focusNode
Didn't know it?
click below
 
Knew it?
click below
Don't Know
Remaining cards (0)
Know
0:00
Embed Code - If you would like this activity on your web page, copy the script below and paste it into your web page.

  Normal Size     Small Size show me how

Higher chemistry

Revision for higher chemistry exam

QuestionAnswer
What are the four ways to speed up a chemical reaction? Use a catalyst, Increase the temperature , Decrease particle size, Increase concentration
What is the equation for relative rate? 1/t
What does collision theory state? for reactant particles to make product they must collide with enough energy and with the correct geometry.
What happens to the reactant molecules when you increase the temperature? The reactant molecules move quicker
When you increase temperature and/or concentration are there more or less successful collisions? More
What is temperature a measure of? A measure of the average kinetic energy of the particles in a substance.
What is the meaning of activation energy? the minimum energy a reactant must have for a successful collision to happen.
For a pair of molecules to react the energy of collision must be what? Greater than or equal to the activation energy
Does temperature affect the activation energy (Ea) No
When you increase the concentration of reactants, what happens on a distribution graph? The shaded area gets bigger which means more particles have energy greater of equal to the activation energy so more successful collisions take place.
When you increase the temperature of an reaction, what happens on a distribution graph? The curve moves to the right. Now the shaded area increases which shows that more reactants have energy so more successful collisions occur.
What happens to the rate of reaction when you increase pressure and why? The particles are forced closer together so they are more likely to have successful collisions.
What happens in a exothermic reaction? energy is lost to the surroundings.
What happens in an endothermic reaction? Energy is gained.
What is enthalpy? The measure of energy stored in a chemical.
If the enthalpy change is negative what type of reaction must it be? Exothermic
If the enthalpy change is higher than the starting starting reactants what type of reaction must it be? Endothermic
What is an activated complex? The unstable arrangement of atoms formed at maximum in a potential energy diagram
What is activation energy measured in? KJmol-1
What is a catalyst? A chemical that speeds up a reaction but does not get used up.
What is a heterogeneous catalyst? A catalyst in a different state than the reactants.
What is a homogenous catalyst? A catalyst in the same state as reactants
What are the three steps of how catalsyts work? Step 1- Reactants absorb onto the surface Step 2- Bonds break and new bonds form to make products Step 3- Products desorb off the surface
If the active site is blocked what do we say has happened to the catalyst? The catalyst has been poisioned
What changes the activation energy? Catalsyts
Does catalysts affect the enthalpy change? No
What russian chemist created the periodic table in 1869 Dmitri Mendeleev
How are the elements arranged on the periodic table? They are arranged based on their atomic number
What is the name of group 1? Alkali metals
What is the name of group 2? Alkali Earth metals
What is the name of group 7? Halogens
What is the name of group 8? Noble gases
What is the name of the group of metals in the middle of the table? Transition metals
Where does metallic bonding occur? In metallic elements
How are metallic elements conductive? They conduct due to the outer electrons of the metal atoms being loosely held so they become delocalised. These Delocalised electrons conduct electricity.
Are metallic bonds strong or weak? Strong
How can we tell metallic bonds are strong? They have a high melting point.
What happens to the boiling point when you go down a group? It decreases
What happens to the atomic size when you go down a group? It increases
What happens to the atomic size when you go across a period? It decreases
What happens to the boiling point as you go across a period? It increases
Are noble gasses monatomic or diatomic? Monatomic
Meaning of monatomic They only exist as single atoms
As noble gasses have low boiling points, what does this say able the forces? They are weak
What are the weakest type of van der waal forces? London Dispersion Forces.
How do London Dispersion forces arise? The electrons in an atom become unevenly distributed causing a temporary dipole, this temporary dipole has a knock on effect to neighbouring atoms. The positive of one atoms and negative of the neighbouring atom causes a weak attraction making an LDF.
What is a covalent bond? The electrostatic attraction between two nuclei and a shared pair of electrons
What is the meaning of a diatomic elements? 2 atoms are joined together
What are the 7 diatomic elements? Hydrogen Oxygen Nitrogen Iodine Chlorine Bromine Fluorine
When covalent molecular substances are melted or boiled what breaks? The covalent bonds or the weak inter molecular forces (LDFs) The weak intermolecular forces break (LDFs)
Why does the melting point increase when the molecule gets bigger? This is because there's more atoms present in a molecule so there are more electrons. As there are more electrons there are more LDF's which means more energy is required to separate the molecules.
What are the three forms of the element carbon? Diamond, Graphite and fullerene
What is the formula for Fullerenes and what shape is it The shape of a fullerene is a sphere with the formula C60
What is the C60 molecule also known as Buckminster
What is the formula for Phosphorus? P4
What's the formula for Sulphur? S8
What is a covalent network? Huge structures with every atom being linked to other atoms by covalent bonds.
What are the properties of covalent networks? They have a high boiling point/ Melting point They are very large
How many bonds does diamond form with neighbouring atoms? 4
How many bonds does Graphite form with neighbouring atoms? 3
What shape is diamond make? Tetrahedral
Meaning of covalent radius? Half the distance between the 2 nucelli in a covalent bond
Meaning of the first ionisation energy of an element The energy required to remove 1 mole of electrons from 1 mole of atoms in gas state.
What are the units for ionisation energy? KJmol-1
What is the meaning of the second ionisation energy? The energy required to remove 1 mole of electrons from 1 mole of position ions in the gas state.
What are the three types of bonding that can be found in compounds? Ionic, Polar covalent and non-polar covalent
What is an ionic Bond? The electrostatic attraction between positive and negative ions.
When do Ionic bonds occur? They occur between Metals and non metals
When do ionic bonds conduct? When molten or in solution
What is electronegativity? The measure of the attraction an atom has for a shared pair of electrons in a covalent bond.
What does it mean if a bond is non-polar The electrons are shared equally in a covalent bond.
What does it mean if a bond is polar? The electrons are shared unequally in a covalent bond.
Are hydrocarbons more likely to polar or non-polar? Non-polar
What is a permanent dipole? A polar molecule
What are the three types of intermolecular forces London dispersion forces Permanent dipole- permanent dipole interactions Hydrogen bonding
What are intermolecular forces also known as? Van der Waal forces
How do permanent dipole- Permanent dipole forces arise? Arise when there is a large difference in electronegativity between two atoms bonded together in a covalent bond.
Are permanent dipole- permanent dipole forces stronger or weaker than LDF's Stronger
When does hydrogen bonding occur? It occurs in compounds that contain a very electronegative element attached to a hydrogen atom.
Hydrogen bonding only occurs between hydrogen and what three element? Nitrogen (N) Oxygen (O) Fluorine (F)
Put the three intermolular forces in order from strongest to weakest Hydrogen bonding PD-PD interactions LDFs
Are intermolecular forces weaker or stronger than ionic/ Covalent boding Weaker
What is viscosity? a measure of a fluid's resistance to flow
What does viscosity depend on? The strength of the hydrogen bonding present between molecules.
When an Ion is surrounded by water molecules it is said to be what? Hydrated
Like dissolves... Like
Meaning of Miscible If two liquids are miscible they will mix together to form 1 layer
Why cant water and oil mix? Because oil is non polar and cannot dissolve in the polar water.
What are esters made from? Alcohols and a carboxylic acid
What group does alcohols contain? A hygroxyl group
How do you determine the main chain in a branked alkanol? Longest continuous chain of carbons that contains the hydrogen group
From which end is the chain numbered End closest to hydroxyl
If the shorted structural formula is- CH2(OH)CH(CH3)CH2CH2CH3 What is the name? 2-methylpentan-1-ol
If the shorted structural formula is- CH3CH2CH(CH3)CH2CH2CH2CH2CH(OH)CH3 What is the name? 6-methyloctan-2-ol
What is the functional group found in carboxylic acids? Carboxyl group
What is the general formula for a carboxylic acid CnH2nCOOH
What are the three mail uses of esters? Perfume, Flavouring, solvents
Why do you heat esters up in a hot water bath? (other than to speed up the reaction) All the reagents are flammable
How do you tell when an ester has been formed? Smell change
How do you tell when an ester has been formed after being poured into a liquid to neutralise it? Forms an oily layer
What is a condensation reaction? Two small molecules join together to make a bigger molecule and eliminate a smaller one usually water but can be methanol ammonia or HCl
Write out the general word equation for the formation of an ester Alcohol + Carboxylic acid -> ester + water
What is the functional group in an ester? Carboxylate
What type of reaction is the formation of an ester? Condesnsation
What type of reaction is the breaking of an ester? Hydrolysis
What is a hydrolysis reaction? A molecule is broken down by the action of water
Is esters reversible (use of acid) yes
Is esters reversible (use of alkali) no
Give two advantages of using Alkaline hydrolysis rather than acid Hydrolysis 1) get a higher yield as reaction is not reversible 2) The salt and alcohol are easier to separate
Why are fats and oils important in our diet? They supply us with energy and vitamins
Are fats m.p. high or low High
Are oils m.p. high or low? low
Why do oils have lower melting points? They are unsaturated
How do you find out if something is saturated or unsaturated? Use bromine water
What can fats and oils be classified as? Triglycerides
What is the other name given to glycerol Propan-1,2,3-triol
Most fats and oils contain what? Gycerol
Why do fats have a high m.p. As fats are closer together they have more LDF's
Why do oils have a low m.p. Due to oils having "kinks" they cannot pack as closely together meaning there is fewer LDF's
What type of reaction is hardening oils? Addition/ Hydrogenation
Are the heads of soap polar or non polar? Polar
Are the tails of soap polar or non-polar? Non-polar
Meaning of Hydrophilic term used to describe parts of molecules that attach to water
Meaning of hydrophobic Parts of a molecule that don't attach to water
Are the heads of soap Hydrophilic or Hydrophobic? Hydrophilic
Are the tails of soap Hydrophilic or Hydrophobic? Hydrophobic
How does soap work? Step 1- The non-polar tail of the soap dissolves in the non-polar grease Step 2- agitation of the mix forms droplets. The polar heads of the soap cover the outside of the droplets which then dissolve in the polar water.
Why do detergents not form a scum? They react with Ca↑2+ and Mg↑2+ ions.
An emulsion contaions what small droplets of 1 substance suspended in another
what are fibrous proteins long and thin and are the major structural materials of animal tissue
What are globular proteins? spiral chains folded into compact units, globular proteins are involved in the maintenance and regulation of life
Why do tertiary alcohols not undergo oxidation? There are no hydrogens on the carbon with hydroxyl
Why are enzymes said to be specific? They have a specific job to do in the body
When amino acids join together to form a protein, what type of reaction is this? Condensation
When proteins break down, what type of reaction is this? Hydrolysis reaction
What is an antioxidant? A chemical that prevents oxidisation
What is stage one of primary alcohols being oxidised? Primary alcohol -> Aldehyde
What is stage 2 of a primary alcohol being oxidised? Aldehyde -> Carboxylic acid
What is the only stage of secondary alcohol being oxidised? Secondary Alcohol -> Keytone
What can alcohols be divided up into? Primary Alcohol Secondary alcohol Tertiary alcohol
What elements are in proteins? Nitrogen Oxygen Carbon Hydrogen
Whats an amide link? The link between monomers
What are enzymes dependant on? Temperature and pH
How does a helix structure form Hydrogen bonds
What 2 groups are in amino acids? Amino group (-NH2) Carboxyl group (-COOH)
What happens when oxygen reacts with edible fats and oils in food? The food gets a rancid flavour
What are essential amino acids? Amino acids that can only be obtained through diet
Meaning of denatured The protein (enzyme) has changed shape
Describe what happens to the oxygen:hydrogen ration in an oxidation reaction In an oxidation reaction the O:H ratio increases and the H:O ratio decreases
What are essential oils? Oils extracted from plants, they usually have distincitve smells
Are Essential oils polar or non-polar? Non-polar
Are Essential oils Volatile? Yes
What compounds do essential oils usually contain? Terpenes
What does volatile mean? Easy to evaporate
What are Essential oils used in? Perfumes, candles, shower gels and cosmetics
How are essential oils extracted from plants? Steam distillation
Are Essential oils Miscible? No
When steam distillation finishes, the essential moves onto what step? Solvent extraction
What is solvent extraction? Where one substance is removed from a mixture of substances
What apparatus is used in solvent extraction? Separation funnel
What are terpenes made from? Isoprenes
What is the chemical name for isoprene? 2-methylbuta-1,3-diene
What is the molecular formula for Isoprene? C5H8
Are terpenes saturated or unsaturated? Unsaturated
What is the general formula for isoprenes (C5H8)n
Why would we want to prevent the oxidation of terpenes? The smell could change
What is sunlight made up from? A rainbow of different colours from red through to violet
What is sunlight also made up from which we cannot see? Ultra violet light
What is Ultra violet light also called? UV light
Why is UV light bad for our skin? It can develop skin cancer
How do we prevent UV light causing skin cancer? use of sunscreen or Sunblock
What compounds does sun block contain? Titanium doixide
What is a free radical? Atoms that have unpaired electrons
What is the first step of free a radical reaction? Initation
What is the second step of a free radical reaction? Propagation
What is the third step of a free radical reaction? Termination
Explain Initation Uv light causes bonds to break Radicals on right
Explain propagation Radicals react with the other element to form new bonds Radicals on both side
Explain Termination Radicals react with others to from stable substance Radicals on left
Explain why chemicals are stored in brown glass bottles The brown glass stops Uv light reaching the chemicals so it stops free radicals from forming and causing the chemical to go off
What is a free radical scavenger? A compound that reacts with free radicals to form stable molecules that prevent chain reactions occuring
What are free radical scavengers added to? Cosmetics, food, plastic
What is the Enthalpy of combustion? The energy released when 1 mole of a substance burns completely into oxygen
Sometimes the enthalpy of combustion is lower than you may worked out, state the three reasons why. Heat lost to surroundings, incomplete combustion, some fuel evaporation has occured before it burned
What 3 things does a calorimeter help with when doing a enthalpy of combustion investigation? Stops heat from going out as all the heat goes into water Pure oxygen is used so there will be no incomplete combustion No evaporation would take place as its a sealed system
What is the enthalpy of solution? The energy change when 1 mole of a substance is dissolved completely in water
What does Hess's Law state? The enthalpy change for a reaction is the same no matter the route taken
What is the meaning of molar bond enthalpy? The energy required to break 1 molecule of bonds
Meaning of mean bond enthalpy? The average bond strength for that bond type in different compounds
Is bond forming exothermic or endothermic? Exothermic
Meaning of oxidation Loss of eletrons
Meaning of reduction Gain of electrons
What is a redox reaction? A reaction when reduction and oxidation happens at the same time
Does a reducing agent lose or gain electrons? Lose
Does a Oxidising agents lose or gain electrons? Gain
What are the conditions said to be if there is an equation that contains H+ Ions Acidic
What is a feedstock? A reactant from which other chemicals must be produced. They are obtained by raw materials
What is a raw material? A useful substance for the chemical industry which is formed naturally
Who controls chemical manufacturing whinin the EU to prevent damage to the environment? SEPA
What does SEPA stand for? Scottish environment protection agency
When a reaction is reversible we actually say that the reaction is in the state of what? Equilibrium
Explain why the equation is written with the two way arrow The arrow is showing that both forward and backwards reaction are occuring at the same time
Created by: andi7
Popular Chemistry sets

 



Voices

Use these flashcards to help memorize information. Look at the large card and try to recall what is on the other side. Then click the card to flip it. If you knew the answer, click the green Know box. Otherwise, click the red Don't know box.

When you've placed seven or more cards in the Don't know box, click "retry" to try those cards again.

If you've accidentally put the card in the wrong box, just click on the card to take it out of the box.

You can also use your keyboard to move the cards as follows:

If you are logged in to your account, this website will remember which cards you know and don't know so that they are in the same box the next time you log in.

When you need a break, try one of the other activities listed below the flashcards like Matching, Snowman, or Hungry Bug. Although it may feel like you're playing a game, your brain is still making more connections with the information to help you out.

To see how well you know the information, try the Quiz or Test activity.

Pass complete!
"Know" box contains:
Time elapsed:
Retries:
restart all cards