PD Bio Units 1, 2, 3 Word Scramble
|
Embed Code - If you would like this activity on your web page, copy the script below and paste it into your web page.
Normal Size Small Size show me how
Normal Size Small Size show me how
Question | Answer |
Most abundant elements within the body | oxygen (65%) carbon (18.5%) hydrogen (9.5%) nitrogen (3.2%) |
Four basic types of tissue | epithelial (surface covering) connective (supporting) muscular (contracting) nervous (conducting) |
Basic structural and functional components | cells |
homeostasis is | a constant internal environment |
negative feedback | counter-change that returns the factor toward the normal value |
normal pH value | 7.35-7.43 |
normal glucose value | 80-120mg/100ml |
positive feedback | changes occurring away from a specific value are continually accelerated |
Abnormal function of homeostasis equals | disease |
Atrophy | a gradual decrease in the size of a tissue or organ as a result of a diminished size of its cells |
Hypertrophy | The growth of an organ or tissue due to an increase in the size of its cells |
Hyperplasia | Stimulated mitotic divisions in cells by increased functional demands, resulting in an increase in tissue or organ size |
Dysplasia | Abnormal maturation of cells within a tissue resulting in variations in size, shape, and appearance of cells |
Metaplasia | The transformation of one cell type to another |
Plasma membrane (gatekeeper) structure | Composed of phospholipid, protein and carb molecules. Lipids provide major barrier for movement across membrane. |
plasma membrane function | gives form to cell. controls passage of materials in and out of the cell. transports molecules both directions |
Cytoplasm Structure | Fluid in which organells are suspended in |
Cytoplasm function | Serves as matrix in which chemical reactions occur. contains intracellular water |
Endoplasmic reticulum structure | system of canals and tubules. two types (rough and smooth) |
Endoplasmic reticulum function | supporting framework of cytoplasm, transports materials and provides attachment for ribosomes |
golgi apparatus structure | cluster of flattened, membranous sacs involved packaging molecules for secretion and synthesis of carbs and steroids |
golgi apparatus function | modification of proteins by adding carbs; packages molecules for secretion; secretes lipids and glycoproteins |
mitochondria(powerhouse) structure | membranous sacs involved in the production of energy (ATP), provides energy for cell |
mitochondria(powerhouse) function | release energy from food molecules and transform energy to ATP |
lysosomes structure | membranous sacs containing hydrolytic enzymes which are involved in the digestion of foreign molecules and worn/damaged cells |
Fibrils and microtubules structure | thin, hollow tubes |
Fibrils and microtubules function | support cytoplasm and transport materials within the cytoplasm |
Nucleus structure | largest organelle. contains chromatin and nucleolus |
nucleus function | contains chromatin (48 chromosomes), nucleolus, and nucleoplasm/ Control center for all cellular functions |
nuclear membrane function | surrounds nucleus, composed of protein and lipid molecules. the perinuclear cistern is the narrow space between the two walls of the nuclear membrane |
chromatin structure | fibrous strands composed of protein and Dna molecules. In a differentiated cell the DNA making up the chromosomes cannot be seen individualls because DNA is unpacked and genes are forming the three types of RNA. |
Chromatin function | conrols cellular activity for carrying on life processes. this material contains the 48 chromosomes, the genetic material which is made up of all the cell genes. |
nucleolus structure | dense, non-membranous mass composed of protein and rRNA molecules |
Nucleolus function | Forms and stores ribosomal RNA (rRNA) |
(plasma membrane) Hydrophilic | mixing with water |
(plasma membrane) Hydrophobic | not mixing with water |
(plasma membrane) integral | embedded in the phospholipid bilayer |
(plasma membrane) peripheral proteins | located on the inner surface, serve as enzymes |
(plasma membrane) phoshpolipid bilayer | forms a major barrier to water soluble substances |
The permeability of a cell membrane to molecules is a function of (there are 4) | 1. Size of molecules 2. Solubility in lipids 3. Ionic charge of molecules 4. The presence of carrier molecules |
(plasma membrane) the carb containing molecules funtion to (there are 5) | 1. Repel negative objects due to - charge 2. Receptors for hormones + regulatory molecules 3. Form specific cell mrkrs,enable like cells to attach and aggregate 4. Enter into immune reactions 5. Cull markers (antigens) which identify blood and tissue |
Diffusion | Characteristics: passive movements of molecules from high concentration to low Energy Source: Molecular motion Example: Exchange of respitory gases in lungs |
Facilitated diffusion | Characteristics: Carrier substances are used to speed processes Energy Source: Carrier energy and molecular motion Example: Glucose entering cell with the help of insulin |
Osmosis | CharacteristicsL Passive movement of solvent molecules through semi-permeable membrane due to concentration difference Energy source: Molecular motion (no ATP) Example: Water movement through cell wall to maintain turgidity |
Filtration | Characteristics: The movement of water and solutes across the cell membrane due to hydrostatic pressure Energy source: Blood pressure Exampe: Removal of wastes within kidneys |
Active transport | Charac: movement in the direction opposite that of diffusion – or – movement from an area of lower concentration to an area of higher concentration Enrgy source: ATP (cellulas energy) Example: Movement of glucose and a.a. through membranes |
Pinocytosis | Membrane engulfs minute droplets of fluid from surroundings Energy source: Cellular energy Example: Membranes forms vacuoles containing solute and solvent |
Phagocytosis | Chrchteris: Membrane engulfs minute droplets of fluid from surroundings Energy source: Cellular energy Examples: White blood cell membrane engulfs bacterial cell |
Aquaporins (osmosis) | cells that form channels specific for the movement of water across cellular membranes |
Tonicity (osmosis) | concentration of nonpenetrating solutes in intrecellular vs extracellular fluids |
Hypotonic solution (osmosis) | dilute, causes cell to swell |
Hypertonic solution (osmosis) | concentrated solution, cell will shrink |
Isotonic solution (osmosis) | Equal concentrations |
Endocytosis | A process in which cell takes in materials from the outside by engulfing and fusing them with its plasma membrane. |
Exocytosis | The process in which the cell releases materials to the outside by discharging them as membrane-bounded vesicles passing through the cell membrane. |
Sorting signal | unique sequence of a.a. on newly produced proteins |
Coat proteins | from the cytosol bind with another specific proteins facing the outer surface of the membrane |
Docking markers | specific proteins facing outer surface of vesicle membrane |
v-SNAREs | docking markers of secretory vesicles, link to t-SNARES |
t-SNARE | found on targeted membrane, link to v-SNARES |
perinuclear cisternae | narrow space between two walls of nuclear membrane |
nuclear pores | extend through membrane |
Nucleoplasm (karyolymph) | gel-like medium of nucleus |
histones | DNA and proteins that make up chromosomes |
In the cytoplasm, the mRNA and tRNA... | are used by the ribosomes for the assembling of proteins |
cisternae | minute tubules |
Rough ER | 1. Ribosomes attached 2. Ribosomes synthesize proteins - mainly integral membrane proteins and proteins to be secreted outside the cell |
Smooth ER | 1. No ribosomes Involved in lipid synthesis, steroid hormone synthesis, and detox of alcohol, drugs, ets (mainly in the liver) |
Drug tolerance | greater quantities to achieve the same effect. |
With increased amounts of smooth ER... | calls can tolerate an increased amount of drugs |
Ribosomes | Consists of subunits. Each subunit is a rbonucleoprotein particle w/ = amounts of RNA and protein |
RNA of ribosomes | rRNA |
Ribosomes are sites for... | protein synthesis |
There are two distinct types of ribosomes: | 1. those bound to membranes (likk on rough ER) 2. those that are free |
proteins that enter the cisternae of golgi apparatus are... | packaged within vesicles and make their way to cell membrane for secretion |
docking marker compose surface proteins and attach to... | docking-marker acceptors |
exocytosis | release of cargo to the outside of cell |
secretion process of proteins synthesized byt he ER and packaged in the GOlgi | look at slide |
cristae | folds of inner membranes, located in the mitochondria |
adenosine triphosphate is also known as... | ATP |
To obtain energy, cells split bond of ATP to obtain... | ADP |
ATP converted to ADP looks like | ATP ------> ADP + Pi + energy for use by cell |
Aerobic exercise | involves large muscle groups, performed for a long time |
Anaerobic exercise | performed for a short amount of time, via glycolysis |
Aging diseases | accumulation of flaws in our mitochondrial DNA |
Proteases | powerful hydrolytic digestive enzymes |
Amount of acid hydrolytic proteases that have been isolated from lysosomes | 30 to 50 |
Rheumatoid arthritis | Pain is due to the release of enzymes by lysosomes into joint capsule and digestion of surrounding tissue |
Atrophy of uterus | normal regression of the uterus following childbirth. Due to lysosome digestive activity. |
*How many different cell types are in the human body? | 200 |
*Molecules that are relatively large can cross the plasma membrane if they are... | Lipid soluble |
Of the 109 elements, how many are normally found in the human tissues? | 26 |
Teeth and bone contains large amounts of: | Calcium |
Thyroid gland contains large amount of: | Iodine |
Atoms are... | smallest portion of an element that retains the characteristics of the element. Different from each other ONLY in NUMBER of basic particles they have (atomic number) |
Electrons | -1 |
Molecular weight of O2 | 2x16=32 |
Covalent bonds | Atoms sharing one, two, or three electron pairs. |
Anions | atoms with an electric charge |
Cations | atoms with a positive charge |
Hydrogen bonds | result from electrostatic interaction between electronegative atom of a molecule and neighboring hydrogen atom. |
Organic compounds all contain Carbon except for... | Co2, CO, NaCN[sodium cyanide}, and NaHCO3 [sodium bicarbonate] |
Three common inorganic compounds are... | Water, Carbon dioxide, and oxygen |
Organic compounds have these 5 chracteristics: | 1. 4 electrons in outer shell 2. can make 4 covalent bonds 3. Present in a large number of compounds 4. Only H is found more often 5. Can bond to many elements, bust most commonly to H, O, N and more C |
Four major classes of organic compounds: | 1. nucleic acids 2. Proteins 3. Carbohydrates 4. Lipids |
A nucleic acid is composed of | nucleotide |
nucleotides in nucleic acid contain... | a nitrogen-containing base, a 5-carbon sugar, and a phosphate group |
a chain of nucleotieds attached through dehydration synthesis by linkages called... | phosphodiester linkages |
single ring compounds of nucleic acids | pyrimidine |
double ring compound of nucleic acid | purine |
adenine and guanine | purines |
cytosine, thymine, uracil | pyrimidines |
DNA are organized into a structure called a | double helix |
Dna molecule consists of what hydrogen bonds? | C-G A-T |
RNA molecule consists of what hydrogen bonds? | C-G A-U |
The principle difference between DNA and RNA is... | In RNA, uracil takes the plae of thymine |
Blueprints of the cell | Nucleic acids |
How many types of RNA are there? | three |
RNA has how many strands? | one. RNA is single stranded |
mRNA is also known as | messenger RNA |
tRNA is also known as | transfer RNA |
rRNA is also known as | robosomal RNA |
messenger RNA acts as a template for | protein synthesis |
mRNA processing involves the capping of | a 5-methyl-guanosine cap |
the second process of mRNA is | polyadenelated tail of Poly-A tail. This helps protect the strand from digestive enzymes while in the cytoplasm |
tRNA carries a.a. in the cytoplasm to | the ribosomes and acts as a translation molecule |
tRNA has an anticodon that | recognizes a sequence of mRNA |
rRNA is made in the | nucleolus. it travels out into the ctoplasm where it is bound to ribosomal proteins |
a ribosome consists of | 60% rRNA 40% protein |
Protein synthesis involves two major steps: | transcription translation |
the mRNA is transported into the cytoplasm where it is translated by | the ribosome and tRNA to make a functional protein |
The principle enzyme that unzips the DNA | Helicase |
enzymes that help keep the DNA uncoiled | Single stranded Binding proteins Topoisomerase |
three enzymes that help in transcription | helicase, single stranded binding proteins and topoisomerase, and polymerase |
Strand that is used as the DNA template | Template or antisense strand |
DNA strand NOT used for transcription | sense strand |
a codon includes how many nucleotides? | 3 |
mRNA strand is read | 5' to 3' |
tRNA | molecule that contains anticodon (recognition region)and a.a. recognition sequence that binds the tRNA to the a.a. |
Inherited diseases | result in defective genes (mutations) that are passed from parent to offspring (ie. sickle cell anemia, Tay-Sachs disease, many other metabolic disorders) |
Proteins are... | long chains of a.a.'s |
Two proteins can differ from eachother in: | 1. Number of a.a. 2. Sequence of a.a. 3. Type of a.a. |
Common function of proteins | form enzymes, hormones, antibodies, serve as receptor sites, act as carrier molecules in active transport, help regulate osmotic solutions, provide tensile strength, buffer systems, metabolize to provide energy |
dipeptide | 2 a.a. joined by one peptide bond |
polypeptide | many a.a. joined by peptide bonds |
memorize structures on 28 | okay? |
chromosome | structure composed of DNA and associated proteins that carry hereditary info |
chromatid | one copy of chromosome formed by DNA replication joined by centromere to another hromatid |
centromere | area on chromatid that holds them together |
gene | region of DNA that codes for a specific protein or RNA. Responsible for traits and synthesis of protein molecules |
diploid (autosomes) | cell that contains two sets of homologous chromosomes |
haploid (sex chromosomes) | contains half the number of chromosomes (sperm and ova) |
chromosomes are responsible for the passing of genetic material from cell to another through the process of | DNA replication |
very long strand of DNA are wrapped around proteins called... | histones |
a chromosome consists of two | chromatids |
humans have how many pairs of homologous chromosomes? | 22 |
photograph of chromosomes | karyotypes |
a person is homozygous when... | homologous chromosomes have alleles that are the same |
a person is heterozygous when... | the person has different alleles |
genotype | specific allelic or genetic composition of an organism |
phenotype | set of physical. observable traits |
when alleles are heterozygous, whate allele is expressed? | the dominant allele |
Down syndrome | there is an extra chromosome 21. also known as trisomy-21 or mongolism. |
Carbohydrates have four principal functions, and they are: | 1. Fuel of a cell 2. Contribute to cellular structure 3. Form a part of the structure of DNA and RNA molecules 4. Can be converted into a storage form such as glycogen that can be converted to glucose |
Monosaccharides | Simple sugars |
Carbohydrates are divided into three categories according to their size: | 1. monosacharrides 2. disacharrides 3. polysaccharides |
isomers | closely related molecules |
disaccharides | when two monosaccharides are hooked together |
3 primary hexose disaccharides are: | Maltose Sucrose Lactose |
The disaccharide maltose is | glucose + glucose |
The disaccharide sucrose is | glucose + fructose |
The disaccharide lactose is | glucose + galactose |
hydrolosis | chemical reaction where a molecule is broken down by a reaction with water |
polysaccharides | complex carbohydrates composed of many simple sugars bonded in long chains |
The two most common polysaccharides of glucose | starch and glycogen |
how glucose is stored in the body | glycogen |
lipids are commonly known as... | fats |
lipids contain mainly... | C, H, and O like carbs, but they contain less oxygen and are insoluble in water |
fats are categorized as either... | saturated or unsaturated |
the fats that are solid at room temp | saturated |
the fats that are liquid at room temp | unsaturated |
3 saturated fats | Butyric CH3-(CH2)2-COOH Palmitic CH3-(CH2)14-COOH Stearic CH3-(CH2)16-COOH |
3 unsaturated fats | Oleic CH3-(CH2)7-CH=CH-(CH2)7-COOH Linoleic CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7-COOH Linolenic (look at page 33) |
The average adult is what percent water? | 50-60% |
How many liters of water are in the average human body? | 40 liters |
Do men or women have more total body water? | Men. Women have more fatty tissues |
Does total body water percentage decrease or increase as you get older? | decrease |
do fatter or thinner people have a higher percent of body water? | thinner. |
Daily water intake/Daily water output | 2500 ml |
in cases of dehydration, what is secreted? | ADH, leading to an increased retention of body fluids |
Where is ADH produced? | The hypothalmus |
Where is ADH secreted from? | the posterior pituitary |
hypovolemia is also known as | dehydration |
hypolemia symptoms | shrinking of brain cells, plasma volume decrease, weight loss, decreased blood pressure |
Hypervolemia is also know as | overhydration |
Hypervolemia response | deceased ADH secretion, increases urinary output |
Strong acids dissociate completely in water to form | hydrogen ions (H+) and anions |
Weak acids hold on to most of their | hydrogen ions |
[H+] = 10^?M | [H+] = 10^-7M |
[OH-]= 10^?M | [OH-]= 10^-7M |
The average young adult has how many liters of blood? | 5-6 liters |
Thrombocytes | Platelets |
Plasma is what percent water? | 90-92% water 7-9% solids |
hematocrit | percentage of cellular elements in blood |
percentage of hematocrit in blood | 45% |
normal hematocrit for males | 42-48% |
normal hematocrit for females | 38-44% |
another word for plasma | serum |
largest portion of the plasma constituents | plasma proteins |
types of plasma proteins | albumin, globulins, Clotting factors |
functions as osmotic pressure regulator | albumin |
Globulins | Alpha beta Gamma |
Alpha and beta function as | carrier vehicles to prevent substances in blood from leaving capillary too rapidly |
function of Gamma | Natural and acquired immunity, antibodies |
origin of plasma proteins | albumin, alpha, beta formed in liver gamma globulins formed in reticulo-endothelial system |
Characteristics of erythrocytes | no nucleus, cannot multiply, biconcave dics, no ER, do not synthesize proteins |
function of erythrocytes | transport hemoglobin |
concentration of erythrocytes in males | 5.5 million/mm^3 |
concentration of erythrocytes in females | 4.5 million/m^3` |
increases # of RBCs | Altitude, muscular exercise, temp, age (higher in infants) |
hematopoiesis | production of all blood cells |
erythropoiesis | production of RBCs |
pathway for erythropoiesis | stem cell-->basophilic erythroblast-->polychromatophilic erythroblast-->normoblast (loss of nucleus)--> reticulocyte--> mature RBC |
Created by:
gemmagrover
Popular Physiology sets